Learn More
Linalyl acetate, 95%, synthetic
CAS: 115-95-7 | C12H20O2 | 196.28 g/mol
Supplier: Thermo Scientific Chemicals 232301000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Linalyl acetate | |
| 115-95-7 | |
| 0.9010g/mL | |
| 85°C | |
| 94% min. (GC) | |
| C12H20O2 | |
| (CH3)2=CHCH2CH2C(CH3)(OOCCH3)CH=CH2 | |
| 100 mL | |
| 15, 5551 | |
| Solubility in water: insoluble in water. Other solubilities: soluble in ethanol,alcohol,ether,diethyl phthal,mineral oil,fixed oils | |
| CC(=CCCC(C)(C=C)OC(=O)C)C | |
| 196.28 | |
| CHEBI:78333 | |
| 95% |
| 95% | |
| Colorless | |
| 220°C | |
| Authentic | |
| Glass bottle | |
| 1.4490 to 1.452 | |
| MFCD00008907 | |
| 0.901 | |
| linalyl acetate, linalool acetate, bergamiol, bergamol, linalol acetate, lynalyl acetate, licareol acetate, bergamot mint oil, acetic acid linalool ester, 3,7-dimethyl-1,6-octadien-3-ol acetate | |
| UWKAYLJWKGQEPM-UHFFFAOYSA-N | |
| 3,7-dimethylocta-1,6-dien-3-yl acetate | |
| 8294 | |
| 196.28 | |
| Liquid |
Chemical Identifiers
| 115-95-7 | |
| 196.28 | |
| UWKAYLJWKGQEPM-UHFFFAOYSA-N | |
| 8294 | |
| 3,7-dimethylocta-1,6-dien-3-yl acetate |
| C12H20O2 | |
| MFCD00008907 | |
| linalyl acetate, linalool acetate, bergamiol, bergamol, linalol acetate, lynalyl acetate, licareol acetate, bergamot mint oil, acetic acid linalool ester, 3,7-dimethyl-1,6-octadien-3-ol acetate | |
| CHEBI:78333 | |
| CC(=CCCC(C)(C=C)OC(=O)C)C |
Safety and Handling
GHS H Statement
Causes skin irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
GHS Signal Word: Warning
EINECSNumber : 204-116-4
RTECSNumber : RG5910000
TSCA : TSCA
RUO – Research Use Only