missing translation for 'onlineSavingsMsg'
Learn More
Learn More
LiChropur™ (S)-(+)-α-Methoxy-α-(trifluoromethyl)phenylacetyl chloride, 99.0%, MilliporeSigma™ Supelco™
For Chiral Derivatization
Supplier: Merck Emd Millipore 65365100MGF
Specifications
| 20445-33-4 | |
| 213°C to 214°C | |
| C10H8ClF3O2 | |
| n20/D 1.469; n20/D 1.469 | |
| 100 mg | |
| PAORVUMOXXAMPL-SECBINFHSA-N | |
| (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride | |
| 252.62 | |
| For chiral derivatization |
| 1.35 g/mL (at 25°C) | |
| Bottomless Glass Bottle with Fused Cone | |
| C6H5C(OCH3)(CF3)COCl | |
| MFCD00067105 | |
| (S)-(+)-MTPA-Cl; Mosher's acid chloride | |
| CO[C@@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F | |
| 252.62 | |
| ≥99.0% (AT) |
Chemical Identifiers
| 20445-33-4 | |
| 252.62 | |
| PAORVUMOXXAMPL-SECBINFHSA-N | |
| (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
| C10H8ClF3O2 | |
| MFCD00067105 | |
| (S)-(+)-MTPA-Cl; Mosher's acid chloride | |
| CO[C@@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F |
LiChropur is a trademark of Merck KGaA, Darmstadt, Germany