missing translation for 'onlineSavingsMsg'
Learn More
Learn More
LiChropur™ N-tert-Butyldimethylsilyl-N-methyltrifluoroacetamide, MilliporeSigma™ Supelco™
N-tert-Butyldimethylsilyl-N-methyltrifluoroacetamide is a silylating reagent which replaces the active hydrogen with tert-Butyldimethylsilyl group. The tert-Butyldimethylsilyl derivatives are found to be more resistant to hydrolysis and stable compared to trimethylsilyl (TMS) derivatives.
Supplier: Merck Emd Millipore 7762610ML
Description
- Suitable for GC-MS analysis since it produces mass spectra, which can be easily interpreted
- It is widely used for the silylation of different alcohols, thiols, phenols, carboxylic acids, amines, and amides
Specifications
| 77377-52-7 | |
| 45°C (Closed Cup) | |
| CF3CON(CH3)Si(CH3)2 C(CH3)3 | |
| UN 1993 C 3 / PGIII | |
| MTBSTFA | |
| CCCC[Si](C)(C)N(C)C(=O)C(F)(F)F | |
| 241.33 | |
| 241.33 | |
| GC Derivatization |
| 1.036 g/mL (at 25°C (literature)) | |
| C9H18F3NOSi | |
| MFCD00009671 | |
| 172°C to 175°C (literature) | |
| NEJIKZHUEMMAEF-UHFFFAOYSA-N | |
| N-(butyldimethylsilyl)-2,2,2-trifluoro-N-methylacetamide | |
| 10 mL | |
| ≥99% (GC) |
Chemical Identifiers
| 77377-52-7 | |
| 241.33 | |
| NEJIKZHUEMMAEF-UHFFFAOYSA-N | |
| N-(butyldimethylsilyl)-2,2,2-trifluoro-N-methylacetamide |
| C9H18F3NOSi | |
| MFCD00009671 | |
| MTBSTFA | |
| CCCC[Si](C)(C)N(C)C(=O)C(F)(F)F |
Safety and Handling
H226 - H315 - H319 - H335
Recommended Storage : 2°C to 8°C
LiChropur is a trademark of Merck KGaA, Darmstadt, Germany