missing translation for 'onlineSavingsMsg'
Learn More
Learn More
LiChropur™ N,O-Bis(trimethylsilyl)trifluoroacetamide with trimethylchlorosilane, 99% (excluding TMCS), MilliporeSigma™ Supelco™
For GC Derivatization, Contains 1% TMCS
Supplier: Merck Emd Millipore 1523825ML
Description
Silylating mixture used for the silylation of various compoundsSpecifications
| 25561-30-2 | |
| 45°C to 50°C (14 mmHg) | |
| C8H18F3NOSi2 | |
| n20/D 1.384 | |
| 25 mL | |
| XCOBLONWWXQEBS-UHFFFAOYSA-N | |
| trimethylsilyl 2,2,2-trifluoro-N-(trimethylsilyl)ethanimidate | |
| 257.40 | |
| For GC derivatization |
| 0.97 g/mL | |
| Glass Bottle | |
| CF3C[=NSi(CH3)3 ]OSi(CH3)3 | |
| MFCD00008269 | |
| Silylating mixture V; BSTFA + TMCS | |
| C[Si](C)(C)OC(=N[Si](C)(C)C)C(F)(F)F | |
| 257.40 | |
| 99% (excluding TMCS) | |
| LiChropur |
Chemical Identifiers
| 25561-30-2 | |
| 257.40 | |
| XCOBLONWWXQEBS-UHFFFAOYSA-N | |
| trimethylsilyl 2,2,2-trifluoro-N-(trimethylsilyl)ethanimidate |
| C8H18F3NOSi2 | |
| MFCD00008269 | |
| Silylating mixture V; BSTFA + TMCS | |
| C[Si](C)(C)OC(=N[Si](C)(C)C)C(F)(F)F |
LiChropur is a trademark of Merck KGaA, Darmstadt, Germany