missing translation for 'onlineSavingsMsg'
Learn More
Learn More
LiChropur™ ™-(-)-α-Methoxy-α-(trifluoromethyl)phenylacetyl chloride, 99.0%, MilliporeSigma™ Supelco™
For Chiral Derivatization
$274.20 - $1008.47
Identifiants chimiques
| CAS | 39637-99-5 |
|---|---|
| Molecular Formula | C10H8ClF3O2 |
| Molecular Weight (g/mol) | 252.62 |
| MDL Number | MFCD00044400 |
| InChI Key | PAORVUMOXXAMPL-VIFPVBQESA-N |
| Synonym | (R)-(-)-MTPA-Cl; Mosher's acid chloride |
| IUPAC Name | (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
| SMILES | CO[C@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F |
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Packaging | Prix | Quantité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Packaging | Prix | Quantité | ||||
|
111018938
|
Merck Emd Millipore
65363100MG |
100 mg | Bottomless Glass Bottle with Fused Cone |
chaque for $274.20
|
|
Connectez-vous ou enregistrez-vous pour vérifier votre prix et la disponibilité.
|
|||
|
111018083
|
Merck Emd Millipore
65363500MG |
500 mg | Bottomless Glass Bottle with Fused Cone |
chaque for $1,008.47
|
|
Connectez-vous ou enregistrez-vous pour vérifier votre prix et la disponibilité.
|
|||
Description
™-(-)-a-Methoxy-a-(trifluoromethyl)phenylacetyl chloride (Mosher's acid chloride) is generally used as a chiral derivatizing agent. It is easily available in enantiomerically pure form. It can form diastereomers with both alcohols and amines.Identifiants chimiques
| 39637-99-5 | |
| 252.62 | |
| PAORVUMOXXAMPL-VIFPVBQESA-N | |
| (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
| C10H8ClF3O2 | |
| MFCD00044400 | |
| (R)-(-)-MTPA-Cl; Mosher's acid chloride | |
| CO[C@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F |
Spécifications
| 1.35 g/mL (at 25°C) | |
| Bottomless Glass Bottle with Fused Cone | |
| C6H5C(OCH3)(CF3)COCl | |
| MFCD00044400 | |
| (R)-(-)-MTPA-Cl; Mosher's acid chloride | |
| CO[C@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F | |
| 252.62 | |
| ≥99.0% (AT) | |
| LiChropur |
| 213°C to 214°C | |
| C10H8ClF3O2 | |
| n20/D 1.469; n20/D 1.47 | |
| 100 mg | |
| PAORVUMOXXAMPL-VIFPVBQESA-N | |
| (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride | |
| 252.62 | |
| For chiral derivatization |
LiChropur is a trademark of Merck KGaA, Darmstadt, Germany