missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Levetiracetam, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 462120250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Levetiracetam | |
| C8H14N2O2 | |
| 25g | |
| levetiracetam, keppra, s-2-2-oxopyrrolidin-1-yl butanamide, keppra xr, 2s-2-2-oxopyrrolidin-1-yl butanamide, levetiracetamum, ucb-l 059, ucb l059, levetiractam, levroxa | |
| HPHUVLMMVZITSG-ZCFIWIBFSA-N | |
| (2R)-2-(2-oxopyrrolidin-1-yl)butanamide | |
| 5284583 | |
| 170.21 |
| 102767-28-2 | |
| MFCD03265610 | |
| -76 | |
| Solubility in water: 104 g/100 mL. Other solubilities: soluble in chloroform, methanol, acetone | |
| CC[C@@H](N1CCCC1=O)C(N)=O | |
| 170.21 | |
| CHEBI:6437 |
Chemical Identifiers
| 102767-28-2 | |
| 170.21 | |
| HPHUVLMMVZITSG-ZCFIWIBFSA-N | |
| 5284583 | |
| (2R)-2-(2-oxopyrrolidin-1-yl)butanamide |
| C8H14N2O2 | |
| MFCD03265610 | |
| levetiracetam, keppra, s-2-2-oxopyrrolidin-1-yl butanamide, keppra xr, 2s-2-2-oxopyrrolidin-1-yl butanamide, levetiracetamum, ucb-l 059, ucb l059, levetiractam, levroxa | |
| CHEBI:6437 | |
| CC[C@@H](N1CCCC1=O)C(N)=O |
Safety and Handling
GHS Signal Word: Warning
RUO â Research Use Only