missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Lamotrigine, 98%
CAS: 84057-84-1 | C9H7Cl2N5 | 256.09 g/mol
$367.45 - $367.45
Chemical Identifiers
| CAS | 84057-84-1 |
|---|---|
| Molecular Formula | C9H7Cl2N5 |
| Molecular Weight (g/mol) | 256.09 |
| MDL Number | MFCD00865333 |
| InChI Key | PYZRQGJRPPTADH-UHFFFAOYSA-N |
| Synonym | lamotrigine, 6-2,3-dichlorophenyl-1,2,4-triazine-3,5-diamine, lamictal, lamictal cd, lamotrigina, lamotriginum, lamictal xr, lamotriginum latin, lamotrigina spanish, lamictal odt |
| PubChem CID | 3878 |
| ChEBI | CHEBI:6367 |
| IUPAC Name | 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | NC1=NN=C(C(N)=N1)C1=CC=CC(Cl)=C1Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC460850050
|
Thermo Scientific Chemicals
460850050 |
5 g |
Each for $367.45
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 84057-84-1 | |
| 256.09 | |
| PYZRQGJRPPTADH-UHFFFAOYSA-N | |
| 3878 | |
| 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
| C9H7Cl2N5 | |
| MFCD00865333 | |
| lamotrigine, 6-2,3-dichlorophenyl-1,2,4-triazine-3,5-diamine, lamictal, lamictal cd, lamotrigina, lamotriginum, lamictal xr, lamotriginum latin, lamotrigina spanish, lamictal odt | |
| CHEBI:6367 | |
| NC1=NN=C(C(N)=N1)C1=CC=CC(Cl)=C1Cl |
Specifications
| 84057-84-1 | |
| 0.5% max. (105°C, 3 h) | |
| 97.5% min. (HPLC) | |
| MFCD00865333 | |
| lamotrigine, 6-2,3-dichlorophenyl-1,2,4-triazine-3,5-diamine, lamictal, lamictal cd, lamotrigina, lamotriginum, lamictal xr, lamotriginum latin, lamotrigina spanish, lamictal odt | |
| PYZRQGJRPPTADH-UHFFFAOYSA-N | |
| 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine | |
| 3878 | |
| 256.09 | |
| Lamotrigine |
| 218.0°C | |
| Authentic | |
| C9H7Cl2N5 | |
| 5 g | |
| Solubility in water: insoluble. Other solubilities: soluble in dmf | |
| NC1=NN=C(C(N)=N1)C1=CC=CC(Cl)=C1Cl | |
| 256.09 | |
| CHEBI:6367 | |
| 98% |
Safety and Handling
GHS H Statement
Toxic if swallowed.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
GHS Signal Word: Danger
EINECSNumber : 281-901-8
RUO – Research Use Only