Learn More
Lamotrigine, 98%
CAS: 84057-84-1 | C9H7Cl2N5 | 256.09 g/mol
Supplier: Thermo Scientific Chemicals 460850050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Lamotrigine | |
| 218.0°C | |
| Authentic | |
| C9H7Cl2N5 | |
| 5 g | |
| Solubility in water: insoluble. Other solubilities: soluble in dmf | |
| NC1=NN=C(C(N)=N1)C1=CC=CC(Cl)=C1Cl | |
| 256.09 | |
| CHEBI:6367 | |
| 98% |
| 84057-84-1 | |
| 0.5% max. (105°C, 3 h) | |
| 97.5% min. (HPLC) | |
| MFCD00865333 | |
| lamotrigine, 6-2,3-dichlorophenyl-1,2,4-triazine-3,5-diamine, lamictal, lamictal cd, lamotrigina, lamotriginum, lamictal xr, lamotriginum latin, lamotrigina spanish, lamictal odt | |
| PYZRQGJRPPTADH-UHFFFAOYSA-N | |
| 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine | |
| 3878 | |
| 256.09 |
Chemical Identifiers
| 84057-84-1 | |
| 256.09 | |
| PYZRQGJRPPTADH-UHFFFAOYSA-N | |
| 3878 | |
| 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
| C9H7Cl2N5 | |
| MFCD00865333 | |
| lamotrigine, 6-2,3-dichlorophenyl-1,2,4-triazine-3,5-diamine, lamictal, lamictal cd, lamotrigina, lamotriginum, lamictal xr, lamotriginum latin, lamotrigina spanish, lamictal odt | |
| CHEBI:6367 | |
| NC1=NN=C(C(N)=N1)C1=CC=CC(Cl)=C1Cl |
Safety and Handling
GHS H Statement
Toxic if swallowed.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
GHS Signal Word: Danger
EINECSNumber : 281-901-8
RUO – Research Use Only