missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Tyrosine, MP Biomedicals™
Supplier: MP Biomedicals Inc 0210318391
Specifications
| L-Tyrosine | |
| White | |
| C9H11NO3 | |
| l-tyrosine, tyrosine, s-tyrosine, p-tyrosine, h-tyr-oh, l-p-tyrosine, 2s-2-amino-3-4-hydroxyphenyl propanoic acid, 4-hydroxy-l-phenylalanine, l---tyrosine, tyrosine, l | |
| N[C@@H](CC1=CC=C(O)C=C1)C(O)=O | |
| (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid | |
| 181.19 | |
| CHEBI:17895 | |
| Powder |
| 60-18-4 | |
| 0.97 | |
| MFCD00002606 | |
| OUYCCCASQSFEME-SVGMAFHSNA-N | |
| 1.4g/mL | |
| 1 kg | |
| 6057 | |
| 181.19 |
Chemical Identifiers
| 60-18-4 | |
| 181.19 | |
| OUYCCCASQSFEME-SVGMAFHSNA-N | |
| 6057 | |
| (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
| C9H11NO3 | |
| MFCD00002606 | |
| l-tyrosine, tyrosine, s-tyrosine, p-tyrosine, h-tyr-oh, l-p-tyrosine, 2s-2-amino-3-4-hydroxyphenyl propanoic acid, 4-hydroxy-l-phenylalanine, l---tyrosine, tyrosine, l | |
| CHEBI:17895 | |
| N[C@@H](CC1=CC=C(O)C=C1)C(O)=O |
Safety and Handling
EINECSNumber : 200-460-4
Recommended Storage : Store at Room Temperature (15 to 30°C).