missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
![MP Biomedicals Inc L-Tyrosine [Free Base], MP Biomedicals](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-60-18-4.jpg-650.jpg)
![MP Biomedicals Inc L-Tyrosine [Free Base], MP Biomedicals](https://assets.fishersci.com/TFS-Assets/CCG/product-images/mpbiomedical.jpg-650.jpg)
MP Biomedicals Inc L-Tyrosine [Free Base], MP Biomedicals
Supplier: MP Biomedicals Inc 0219475980
Specifications
| L-Tyrosine [Free Base] | |
| C9H11NO3 | |
| l-tyrosine, tyrosine, s-tyrosine, p-tyrosine, h-tyr-oh, l-p-tyrosine, 2s-2-amino-3-4-hydroxyphenyl propanoic acid, 4-hydroxy-l-phenylalanine, l---tyrosine, tyrosine, l | |
| NC(CC1=CC=C(O)C=C1)C(O)=O | |
| 181.19 | |
| CHEBI:17895 | |
| Cell Culture Reagent | |
| Crystalline |
| 60-18-4 | |
| MFCD00002606 | |
| OUYCCCASQSFEME-UHFFFAOYNA-N | |
| 2-amino-3-(4-hydroxyphenyl)propanoic acid | |
| 6057 | |
| 181.2 | |
| 100 g |
Chemical Identifiers
| 60-18-4 | |
| 181.19 | |
| OUYCCCASQSFEME-UHFFFAOYNA-N | |
| 6057 | |
| 2-amino-3-(4-hydroxyphenyl)propanoic acid |
| C9H11NO3 | |
| MFCD00002606 | |
| l-tyrosine, tyrosine, s-tyrosine, p-tyrosine, h-tyr-oh, l-p-tyrosine, 2s-2-amino-3-4-hydroxyphenyl propanoic acid, 4-hydroxy-l-phenylalanine, l---tyrosine, tyrosine, l | |
| CHEBI:17895 | |
| NC(CC1=CC=C(O)C=C1)C(O)=O |
Safety and Handling
Recommended Storage : Room temperature