missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Tyrosine, FCC, 98.5-101.5%, Spectrum™ Chemical
T1150, 60-18-4, C9H11NO3
Supplier: Spectrum Chemical Mfg Cor T11505KG
| Quantity | 5 kg |
|---|---|
| Packaging | Poly Pail |
Description
Spectrum™ Chemical L-Tyrosine, FCC - The FCC grade meets the requirements of the Food Chemical Codex indicates and is suitable for all food, beverage and nutritional supplement applications. Spectrum Chemical offers over 300 Food grade chemical ingredients packaged in laboratory size bottles to production drum quantities and are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Chemical Identifiers
| 60-18-4 | |
| 181.19 | |
| OUYCCCASQSFEME-SVGMAFHSNA-N | |
| N[C@@H](CC1=CC=C(O)C=C1)C(O)=O |
| C9H11NO3 | |
| MFCD00002606 | |
| (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
Specifications
| 60-18-4 | |
| 0.001 | |
| C9H11NO3 | |
| MFCD00002606 | |
| N[C@@H](CC1=CC=C(O)C=C1)C(O)=O | |
| 181.19 | |
| -10.0° to -11.0° | |
| FCC |
| 100% | |
| 0.003 | |
| Poly Pail | |
| OUYCCCASQSFEME-SVGMAFHSNA-N | |
| (2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid | |
| 5 kg | |
| 98.5 to 101.5% |