missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Thyroxine, 98%
CAS: 51-48-9 | C15H11I4NO4 | 776.87 g/mol
$150.22 - $513.70
Chemical Identifiers
| CAS | 51-48-9 |
|---|---|
| Molecular Formula | C15H11I4NO4 |
| Molecular Weight (g/mol) | 776.87 |
| MDL Number | MFCD00002595 |
| InChI Key | XUIIKFGFIJCVMT-UHFFFAOYNA-N |
| Synonym | l-thyroxine, levothyroxine, thyroxine, thyroxin, synthroid, tetraiodothyronine, thyrax, levothyroxin, thyratabs, thyreoideum |
| PubChem CID | 5819 |
| ChEBI | CHEBI:18332 |
| IUPAC Name | 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
| SMILES | NC(CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAJ6260603
|
Thermo Scientific Chemicals
J6260603 |
1 g |
Each for $150.22
|
|
|||||
|
AAJ6260606
|
Thermo Scientific Chemicals
J6260606 |
5 g |
Each for $513.70
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 51-48-9 | |
| 776.87 | |
| XUIIKFGFIJCVMT-UHFFFAOYNA-N | |
| 5819 | |
| 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
| C15H11I4NO4 | |
| MFCD00002595 | |
| l-thyroxine, levothyroxine, thyroxine, thyroxin, synthroid, tetraiodothyronine, thyrax, levothyroxin, thyratabs, thyreoideum | |
| CHEBI:18332 | |
| NC(CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O |
Specifications
| 51-48-9 | |
| Brown to White | |
| C15H11I4NO4 | |
| 1 g | |
| Light sensitive | |
| l-thyroxine, levothyroxine, thyroxine, thyroxin, synthroid, tetraiodothyronine, thyrax, levothyroxin, thyratabs, thyreoideum | |
| XUIIKFGFIJCVMT-UHFFFAOYNA-N | |
| 2-amino-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid | |
| 5819 | |
| 776.87 | |
| Crystalline Powder |
| 235°C to 236°C | |
| Odorless | |
| MFCD00002595 | |
| 2228515 | |
| 14,9415 | |
| Dissolves in 4M ammonium hydroxide in Methanol at 50mg/ml | |
| NC(CC1=CC(I)=C(OC2=CC(I)=C(O)C(I)=C2)C(I)=C1)C(O)=O | |
| 776.87 | |
| CHEBI:18332 | |
| 98% | |
| L-Thyroxine |
Safety and Handling
P264-P270-P301+P312-P330-P501c
H302
EINECSNumber : 200-101-1
RTECSNumber : YP2833500
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only