missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals L(+)-Rhamnose monohydrate, 99%
CAS: 10030-85-0 | C6H12O5 | 164.16 g/mol
Supplier: Thermo Scientific Chemicals 174081000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| L(+)-Rhamnose monohydrate | |
| 91.0°C to 93.0°C | |
| 0.2% max. | |
| 98.5% min. (ELSD) (HPLC) | |
| C6H12O5 | |
| 100 g | |
| + 8.20 | |
| Solubility in water: 300g/L (20°C). Other solubilities: soluble in ethanol and methanol | |
| C[C@@H]1O[C@@H](O)[C@H](O)[C@H](O)[C@H]1O | |
| 164.16 | |
| 182.17 | |
| Crystalline Powder or Crystals |
| 10030-85-0 | |
| White | |
| Authentic | |
| Glass bottle | |
| MFCD00149363,MFCD00136036 | |
| + 8.20 (20.00°C c=4.5,H2O) | |
| l-+-rhamnose monohydrate, 2r,3r,4s,5s-2,3,4,5-tetrahydroxyhexanal hydrate, l + rhamnopyranose, l-mannose, 6-deoxy-, monohydrate, 6-deoxy-l-mannose hydrate, rhamnose hydrate, l-rha hydrate, l-rhamnose hydrate, l +-rhamnose hydrate, a-l-rhamnose monohydrate | |
| SHZGCJCMOBCMKK-HGVZOGFYSA-N | |
| (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;hydrate | |
| 20849066 | |
| 99% |
Chemical Identifiers
| 10030-85-0 | |
| 164.16 | |
| SHZGCJCMOBCMKK-HGVZOGFYSA-N | |
| 20849066 | |
| C[C@@H]1O[C@@H](O)[C@H](O)[C@H](O)[C@H]1O |
| C6H12O5 | |
| MFCD00149363,MFCD00136036 | |
| l-+-rhamnose monohydrate, 2r,3r,4s,5s-2,3,4,5-tetrahydroxyhexanal hydrate, l + rhamnopyranose, l-mannose, 6-deoxy-, monohydrate, 6-deoxy-l-mannose hydrate, rhamnose hydrate, l-rha hydrate, l-rhamnose hydrate, l +-rhamnose hydrate, a-l-rhamnose monohydrate | |
| (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;hydrate |
RUO – Research Use Only