missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
L(+)-Potassium hydrogen tartrate, 99%, Thermo Scientific Chemicals
$83.23 - $191.74
Chemical Identifiers
| CAS | 868-14-4 |
|---|---|
| Molecular Formula | C4H5KO6 |
| Molecular Weight (g/mol) | 188.18 |
| MDL Number | MFCD00065392,MFCD00071626,MFCD00064206 |
| InChI Key | KYKNRZGSIGMXFH-ZVGUSBNCSA-M |
| Synonym | potassium bitartrate, l +-potassium hydrogen tartrate, potassium 3-carboxy-2,3-dihydroxypropanoate, monopotassium tartrate, potassium acid tartrate, kaliumtartrat, potassium hydrogentartrate, 1-potassium hydrogentartrate, ksc657e1t, butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 |
| PubChem CID | 24193652 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;potassium |
| SMILES | [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC222672500
|
Thermo Scientific Chemicals
222672500 |
250 g | Plastic bottle |
Each for $83.23
|
|
||||
|
AC222670010
|
Thermo Scientific Chemicals
222670010 |
1 kg | Plastic bottle |
Each for $191.74
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 868-14-4 | |
| 188.18 | |
| KYKNRZGSIGMXFH-ZVGUSBNCSA-M | |
| 24193652 | |
| [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O |
| C4H5KO6 | |
| MFCD00065392,MFCD00071626,MFCD00064206 | |
| potassium bitartrate, l +-potassium hydrogen tartrate, potassium 3-carboxy-2,3-dihydroxypropanoate, monopotassium tartrate, potassium acid tartrate, kaliumtartrat, potassium hydrogentartrate, 1-potassium hydrogentartrate, ksc657e1t, butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 | |
| 2,3-dihydroxybutanedioic acid;potassium |
Specifications
| 868-14-4 | |
| 1.9500g/mL | |
| Authentic | |
| Plastic bottle | |
| KO2CCH(OH)CH(OH)CO2H | |
| 250 g | |
| 1.95 | |
| + 32.50 (20.00°C c=10,1N NaOH) | |
| potassium bitartrate, l +-potassium hydrogen tartrate, potassium 3-carboxy-2,3-dihydroxypropanoate, monopotassium tartrate, potassium acid tartrate, kaliumtartrat, potassium hydrogentartrate, 1-potassium hydrogentartrate, ksc657e1t, butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 | |
| [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O | |
| 188.18 | |
| 188.18 | |
| Crystals or Powder |
| Colorless or White | |
| 0.5% max. (105°C) | |
| 99% | |
| C4H5KO6 | |
| MFCD00065392,MFCD00071626,MFCD00064206 | |
| 03, 529 | |
| 15, 7736 | |
| + 32.50 | |
| KYKNRZGSIGMXFH-ZVGUSBNCSA-M | |
| 2,3-dihydroxybutanedioic acid;potassium | |
| 24193652 | |
| 99% | |
| L(+)-Potassium hydrogen tartrate |
Safety and Handling
EINECSNumber : 212-769-1
RUO – Research Use Only