missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Phenylalanine methyl ester hydrochloride, 98%
CAS: 7524-50-7 | C10H14ClNO2 | 215.68 g/mol
Supplier: Thermo Scientific Chemicals 130320100
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| L-Phenylalanine methyl ester hydrochloride | |
| 7524-50-7 | |
| White | |
| 97.5% min. (Argentometry) | |
| C10H14ClNO2 | |
| MFCD00012489 | |
| 14,499 | |
| + 37.00 | |
| SWVMLNPDTIFDDY-UHFFFAOYNA-N | |
| methyl (2S)-2-amino-3-phenylpropanoate;hydrochloride | |
| 75736 | |
| 98% |
| 98% | |
| 156.0°C to 160.0°C | |
| Authentic | |
| Glass bottle | |
| C6H5CH2CH(NH2)CO2CH3·HCl | |
| 10 g | |
| + 37.00 (20.00°C c=2,C2H5OH) | |
| l-phenylalanine methyl ester hydrochloride, h-phe-ome.hcl, methyl l-phenylalaninate hydrochloride, s-methyl 2-amino-3-phenylpropanoate hydrochloride, unii-47hk4y94ja, h-phe-ome hcl, h-phe-ome hydrochloride, l-phenylalanine, methyl ester, hydrochloride, l-phenylalanine methyl ester hcl | |
| [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1 | |
| 215.68 | |
| 215.68 | |
| Fine Crystalline Powder |
Chemical Identifiers
| 7524-50-7 | |
| 215.68 | |
| SWVMLNPDTIFDDY-UHFFFAOYNA-N | |
| 75736 |
| C10H14ClNO2 | |
| MFCD00012489 | |
| l-phenylalanine methyl ester hydrochloride, h-phe-ome.hcl, methyl l-phenylalaninate hydrochloride, s-methyl 2-amino-3-phenylpropanoate hydrochloride, unii-47hk4y94ja, h-phe-ome hcl, h-phe-ome hydrochloride, l-phenylalanine, methyl ester, hydrochloride, l-phenylalanine methyl ester hcl | |
| [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1 |
Safety and Handling
EINECSNumber : 231-383-4
RUO – Research Use Only