missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Histidine Monohydrochloride, Monohydrate, 98.5-101.5%, Spectrum™ Chemical
HI125, 5934-29-2, C6H9N3O2·HCl·H2O
Supplier: Spectrum Chemical Mfg Cor HI1255KG
Description
Spectrum™ Chemical L-Histidine Monohydrochloride, Monohydrate , also known as 2-Amino-3-(1H-imidazol-4-yl)propanoic acid, is an α-amino acid with an imidazole functional group. Ungraded products supplied by Spectrum are indicative of a grade suitable for general industrial use or research purposes and typically are not suitable for human consumption or therapeutic use. These materials may or may not have a Certificate of Analysis available.Specifications
| 5934-29-2 | |
| 0.015% | |
| 0.1% | |
| C6H12ClN3O3 | |
| MFCD00151027 | |
| CMXXUDSWGMGYLZ-XRIGFGBMSA-N | |
| (2S)-2-amino-3-(1H-imidazol-4-yl)propanoic acid hydrate hydrochloride | |
| 209.63 | |
| Reagent |
| 100% | |
| 0.001% | |
| 0.3% | |
| Poly Pail | |
| +8.5° to +10.5° | |
| O.Cl.N[C@@H](CC1=CNC=N1)C(O)=O | |
| 5 kg | |
| 98.5 to 101.5% |
Chemical Identifiers
| 5934-29-2 | |
| 209.63 | |
| CMXXUDSWGMGYLZ-XRIGFGBMSA-N | |
| O.Cl.N[C@@H](CC1=CNC=N1)C(O)=O |
| C6H12ClN3O3 | |
| MFCD00151027 | |
| (2S)-2-amino-3-(1H-imidazol-4-yl)propanoic acid hydrate hydrochloride |