missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals L(+)-Glutamic acid monosodium salt monohydrate, 99%
CAS: 6106-04-03 | C5H8NNaO4·H2O | 187.13 g/mol
$174.82 - $1359.63
Chemical Identifiers
| CAS | 6106-04-03 |
|---|---|
| Molecular Formula | C5H8NNaO4·H2O |
| Molecular Weight (g/mol) | 187.13 |
| MDL Number | MFCD00150138 |
| InChI Key | GJBHGUUFMNITCI-QTNFYWBSSA-M |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC119940010
|
Thermo Scientific Chemicals
119940010 |
1 kg | Plastic Bottle |
Each for $174.82
|
|
||||
|
AC119940025
|
Thermo Scientific Chemicals
119940025 |
2.5 kg | Plastic Bottle |
Each for $348.82
|
|
||||
|
AC119940100
|
Thermo Scientific Chemicals
119940100 |
10 kg | Plastic Drum |
Each for $1,359.63
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 232.0°C | |
| White | |
| Authentic | |
| 0.99 | |
| Plastic Bottle | |
| MFCD00150138 | |
| 500ppm max | |
| Solubility in water: soluble. Other solubilities: sparingly soluble in alcohol | |
| O.[Na+].N[C@@H](CCC([O-])=O)C(O)=O | |
| + 25.00 (20.00°C c=10,2 N HCl) | |
| 1 kg | |
| 187.13 | |
| Crystalline Powder or Crystals |
| 6106-04-03 | |
| 2000ppm max | |
| 0.5% max. (100°C, 5 hrs) | |
| C5H8NNaO4·H2O | |
| NaO2CCH2CH2CH(NH2)CO2H·H2O | |
| + 25.00 | |
| l-thyroxine sodium salt pentahydrate, l-thyroxine sodium pentahydrate, sodium l-thyroxine pentahydrate, sodium levothyroxine, levothyroxine sodium, 3-4-4-hydroxy-3,5-diiodophenoxy-3,5-diiodophenyl-l-alanine sodium salt, levothyroxine sodium pentahydrate, l-tyrosine, o-4-hydroxy-3,5-diiodophenyl-3,5-diiodo-, sodium salt, pentahydrate, o-4-hydroxy-3,5-diiodophenyl-3,5-diiodo-l-tyrosine sodium salt pentahydrate | |
| GJBHGUUFMNITCI-QTNFYWBSSA-M | |
| sodium (4S)-4-amino-4-carboxybutanoate hydrate | |
| 187.13 | |
| 23665037 | |
| 99% | |
| L(+)-Glutamic acid monosodium salt monohydrate |
RUO – Research Use Only