missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals L(+)-Glutamic acid monosodium salt monohydrate, 99%
CAS: 6106-04-03 | C5H8NNaO4·H2O | 187.13 g/mol
Supplier: Thermo Scientific Chemicals 119940010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 232.0°C | |
| 6106-04-03 | |
| 2000ppm max | |
| 0.5% max. (100°C, 5 hrs) | |
| C5H8NNaO4·H2O | |
| NaO2CCH2CH2CH(NH2)CO2H·H2O | |
| + 25.00 | |
| l-thyroxine sodium salt pentahydrate, l-thyroxine sodium pentahydrate, sodium l-thyroxine pentahydrate, sodium levothyroxine, levothyroxine sodium, 3-4-4-hydroxy-3,5-diiodophenoxy-3,5-diiodophenyl-l-alanine sodium salt, levothyroxine sodium pentahydrate, l-tyrosine, o-4-hydroxy-3,5-diiodophenyl-3,5-diiodo-, sodium salt, pentahydrate, o-4-hydroxy-3,5-diiodophenyl-3,5-diiodo-l-tyrosine sodium salt pentahydrate | |
| GJBHGUUFMNITCI-QTNFYWBSSA-M | |
| sodium (4S)-4-amino-4-carboxybutanoate hydrate | |
| 187.13 | |
| 23665037 | |
| 99% |
| L(+)-Glutamic acid monosodium salt monohydrate | |
| White | |
| Authentic | |
| 0.99 | |
| Plastic Bottle | |
| MFCD00150138 | |
| 500ppm max | |
| Solubility in water: soluble. Other solubilities: sparingly soluble in alcohol | |
| O.[Na+].N[C@@H](CCC([O-])=O)C(O)=O | |
| + 25.00 (20.00°C c=10,2 N HCl) | |
| 1 kg | |
| 187.13 | |
| Crystalline Powder or Crystals |
Chemical Identifiers
| 6106-04-03 | |
| 187.13 | |
| GJBHGUUFMNITCI-QTNFYWBSSA-M |
| C5H8NNaO4·H2O | |
| MFCD00150138 |
RUO – Research Use Only