missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Glutamic Acid, free acid, ≥99%, MP Biomedicals™
$66.64 - $142.44
Chemical Identifiers
| CAS | 142-47-2 |
|---|---|
| Molecular Formula | C5H8NNaO4 |
| Molecular Weight (g/mol) | 169.11 |
| MDL Number | MFCD00150138 |
| InChI Key | LPUQAYUQRXPFSQ-UHFFFAOYNA-M |
| Synonym | natriumglutaminat, sodium glutamate, glutamate sodium, monosodioglutammato, sodium l-glutamate, glutammato monosodico, monosodium l-glutamate, sodium hydrogen glutamate, monosodium glutamate, glutamic acid, monosodium salt |
| PubChem CID | 86748263 |
| IUPAC Name | sodium 2-amino-4-carboxybutanoate |
| SMILES | [Na+].NC(CCC(O)=O)C([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN10180080
|
MP Biomedicals Inc
0210180080 |
100 g |
Each for $66.64
|
|
|||||
|
ICN10180091
|
MP Biomedicals Inc
0210180091 |
1 kg |
Each for $142.44
|
|
|||||
Chemical Identifiers
| 142-47-2 | |
| 169.11 | |
| LPUQAYUQRXPFSQ-UHFFFAOYNA-M | |
| 86748263 | |
| [Na+].NC(CCC(O)=O)C([O-])=O |
| C5H8NNaO4 | |
| MFCD00150138 | |
| natriumglutaminat, sodium glutamate, glutamate sodium, monosodioglutammato, sodium l-glutamate, glutammato monosodico, monosodium l-glutamate, sodium hydrogen glutamate, monosodium glutamate, glutamic acid, monosodium salt | |
| sodium 2-amino-4-carboxybutanoate |
Specifications
| 142-47-2 | |
| ≥99% | |
| MFCD00150138 | |
| LPUQAYUQRXPFSQ-UHFFFAOYNA-M | |
| 1.538g/mL at 20°C | |
| 100 g | |
| 86748263 | |
| Powder |
| White | |
| C5H8NNaO4 | |
| natriumglutaminat, sodium glutamate, glutamate sodium, monosodioglutammato, sodium l-glutamate, glutammato monosodico, monosodium l-glutamate, sodium hydrogen glutamate, monosodium glutamate, glutamic acid, monosodium salt | |
| [Na+].NC(CCC(O)=O)C([O-])=O | |
| sodium 2-amino-4-carboxybutanoate | |
| 169.11 | |
| 187.13 | |
| L-Glutamic acid Monosodium Salt |
Safety and Handling
EINECSNumber : 205-538-1
Recommended Storage : Store at room temperature (15 to 30°C).