missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Glutamic acid dimethyl ester hydrochloride, 99%, pure, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 441940500
| Quantity | 50g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 23150-65-4 | |
| 210.63 | |
| BPHCSYSXOKTCMA-UHFFFAOYNA-N | |
| 12917568 | |
| [Cl].COC(=O)CCC(N)C(=O)OC |
| C7H13ClNO4 | |
| MFCD00038879 | |
| l-glutamic acid dimethyl ester hydrochloride, h-glu ome-ome.hcl, dimethyl l-glutamate hydrochloride, s-dimethyl 2-aminopentanedioate hydrochloride, unii-185vc5x3pf, 1,5-dimethyl 2s-2-aminopentanedioate hydrochloride, h-glu ome-ome inverted exclamation mark currencyhcl, s-dimethyl 2-aminopentanedioate hcl, glutamic acid dimethyl ester hydrochloride, dimethyl glutamic acid hydrochloride | |
| dimethyl (2S)-2-aminopentanedioate;hydrochloride |
Specifications
| L-Glutamic acid dimethyl ester hydrochloride | |
| Authentic | |
| C7H13ClNO4 | |
| 50g | |
| l-glutamic acid dimethyl ester hydrochloride, h-glu ome-ome.hcl, dimethyl l-glutamate hydrochloride, s-dimethyl 2-aminopentanedioate hydrochloride, unii-185vc5x3pf, 1,5-dimethyl 2s-2-aminopentanedioate hydrochloride, h-glu ome-ome inverted exclamation mark currencyhcl, s-dimethyl 2-aminopentanedioate hcl, glutamic acid dimethyl ester hydrochloride, dimethyl glutamic acid hydrochloride | |
| [Cl].COC(=O)CCC(N)C(=O)OC | |
| 210.63 | |
| 211.65 | |
| Pure |
| 23150-65-4 | |
| 98.5% min. (Argentometry) | |
| MFCD00038879 | |
| 26 | |
| BPHCSYSXOKTCMA-UHFFFAOYNA-N | |
| dimethyl (2S)-2-aminopentanedioate;hydrochloride | |
| 12917568 | |
| 99% |
Safety and Handling
EINECSNumber : 245-461-