missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Cysteic acid monohydrate, 99%, Thermo Scientific Chemicals
$201.59 - $201.59
Chemical Identifiers
| CAS | 23537-25-9 |
|---|---|
| Molecular Formula | C3H6NO5S |
| Molecular Weight (g/mol) | 168.14 |
| MDL Number | MFCD00149544 |
| InChI Key | XVOYSCVBGLVSOL-REOHCLBHSA-M |
| Synonym | l-cysteic acid monohydrate, unii-vn8x20t18r, cysteic acid monohydrate, l, r-2-amino-3-sulfopropanoic acid hydrate, l-alanine, 3-sulfo-, monohydrate, cysteinesulfonic acid hydrate, h-cys o 2-oh.h2o, l-cysteic acid hydrate, l-cysteic acid monohydrate mi, alanine, 3-sulfo-, monohydrate, l |
| PubChem CID | 12308854 |
| IUPAC Name | (2R)-2-amino-3-sulfopropanoic acid;hydrate |
| SMILES | [NH3+][C@@H](CS([O-])(=O)=O)C([O-])=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC452840100
|
Thermo Scientific Chemicals
452840100 |
10 g |
Each for $201.59
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 23537-25-9 | |
| 168.14 | |
| XVOYSCVBGLVSOL-REOHCLBHSA-M | |
| 12308854 | |
| [NH3+][C@@H](CS([O-])(=O)=O)C([O-])=O |
| C3H6NO5S | |
| MFCD00149544 | |
| l-cysteic acid monohydrate, unii-vn8x20t18r, cysteic acid monohydrate, l, r-2-amino-3-sulfopropanoic acid hydrate, l-alanine, 3-sulfo-, monohydrate, cysteinesulfonic acid hydrate, h-cys o 2-oh.h2o, l-cysteic acid hydrate, l-cysteic acid monohydrate mi, alanine, 3-sulfo-, monohydrate, l | |
| (2R)-2-amino-3-sulfopropanoic acid;hydrate |
Specifications
| 23537-25-9 | |
| Authentic | |
| C3H6NO5S | |
| MFCD00149544 | |
| + 8.00 (20.00°C c=5, H2O) | |
| l-cysteic acid monohydrate, unii-vn8x20t18r, cysteic acid monohydrate, l, r-2-amino-3-sulfopropanoic acid hydrate, l-alanine, 3-sulfo-, monohydrate, cysteinesulfonic acid hydrate, h-cys o 2-oh.h2o, l-cysteic acid hydrate, l-cysteic acid monohydrate mi, alanine, 3-sulfo-, monohydrate, l | |
| XVOYSCVBGLVSOL-REOHCLBHSA-M | |
| (2R)-2-amino-3-sulfopropanoic acid;hydrate | |
| 12308854 | |
| 99% |
| 253.0°C to 254.5°C | |
| 98.5% min | |
| HO3SCH2CH(NH2)CO2H·H2O | |
| 10 g | |
| + 8.00 | |
| Solubility in water: soluble. Other solubilities: insoluble in alcohol | |
| [NH3+][C@@H](CS([O-])(=O)=O)C([O-])=O | |
| 168.14 | |
| 187.17 | |
| L-Cysteic acid monohydrate |
RUO – Research Use Only