missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Bornyl acetate, 95%
CAS: 5655-61-8 | C12H20O2 | 196.29 g/mol
Supplier: Thermo Scientific Chemicals 106550050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| L-Bornyl acetate | |
| 5655-61-8 | |
| 0.9875g/mL | |
| 84°C | |
| 98% min. (as C12H20O2) Total esters (GC) | |
| C12H20O2 | |
| MFCD00867808,MFCD00135942,MFCD00135942 | |
| 06,82 | |
| 15,1341 | |
| bornyl acetate, -bornyl acetate | |
| KGEKLUUHTZCSIP-HOSYDEDBSA-N | |
| [(1R,3S)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] acetate | |
| 44630108 | |
| 95% |
| 95% | |
| Colorless | |
| 223°C to 224°C | |
| Authentic | |
| Glass bottle | |
| 1.4620 to 1.465 | |
| 5 g | |
| 0.9875 | |
| -38 | |
| Solubility in water: .. Other solubilities: miscible with 95% alcohol and ether | |
| CC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C | |
| 196.29 | |
| 196.29 | |
| Liquid |
Chemical Identifiers
| 5655-61-8 | |
| 196.29 | |
| KGEKLUUHTZCSIP-HOSYDEDBSA-N | |
| 44630108 | |
| CC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| C12H20O2 | |
| MFCD00867808,MFCD00135942,MFCD00135942 | |
| bornyl acetate, -bornyl acetate | |
| [(1R,3S)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] acetate |
Safety and Handling
EINECSNumber : 227-101-4
TSCA : TSCA
RUO – Research Use Only