Learn More
Thermo Scientific Chemicals L-Aspartic acid monosodium salt monohydrate, 99%
CAS: 323194-76-9 | C4H8NNaO5 | 173.10 g/mol
Supplier: Thermo Scientific Chemicals B2232122
| Quantity | 100 g |
|---|
Description
L-Aspartic acid monosodium salt monohydrate is used as a principal neurotransmitter for fast synaptic excitation.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
ApplicationsL-Aspartic acid monosodium salt monohydrate is used as a principal neurotransmitter for fast synaptic excitation.
Solubility
Soluble in cold water.
Notes
Incompatible with strong oxidizing agents.
Chemical Identifiers
| 323194-76-9 | |
| 173.10 | |
| PPTHNBYUFXSJPS-UHFFFAOYNA-M | |
| 23679051 |
| C4H8NNaO5 | |
| MFCD00152960 | |
| sodium l-aspartate, l-aspartic acid sodium salt monohydrate, sodium aspartate monohydrate, sodium l-aspartate monohydrate, s-2-aminobutanedioic acid sodium salt, l-aspartic acid monosodium salt monohydrate, l-aspartic acid, monosodium salt, monohydrate, sodium +-aspartate hydrate, l-aspartic acid sodium salt monohydrate tlc, l-aspartic acid sodium salt monohydrate nt | |
| O.[Na+].NC(CC(O)=O)C([O-])=O |
Specifications
| L-Aspartic acid monosodium salt monohydrate | |
| C4H8NNaO5 | |
| sodium l-aspartate, l-aspartic acid sodium salt monohydrate, sodium aspartate monohydrate, sodium l-aspartate monohydrate, s-2-aminobutanedioic acid sodium salt, l-aspartic acid monosodium salt monohydrate, l-aspartic acid, monosodium salt, monohydrate, sodium +-aspartate hydrate, l-aspartic acid sodium salt monohydrate tlc, l-aspartic acid sodium salt monohydrate nt | |
| PPTHNBYUFXSJPS-UHFFFAOYNA-M | |
| sodium 2-amino-3-carboxypropanoate hydrate | |
| 173.10 | |
| 173.11 (155.10 Anhydrous) |
| 323194-76-9 | |
| MFCD00152960 | |
| Soluble in cold water. | |
| O.[Na+].NC(CC(O)=O)C([O-])=O | |
| 100 g | |
| 23679051 | |
| 99% |
Safety and Handling
EINECSNumber : 223-264-0
TSCA : No
Recommended Storage : Ambient temperatures