missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Aspartic acid dimethyl ester hydrochloride, 98%
CAS: 32213-95-9 | C6H12ClNO4 | 197.615 g/mol
Chemical Identifiers
| CAS | 32213-95-9 |
|---|---|
| Molecular Formula | C6H12ClNO4 |
| Molecular Weight (g/mol) | 197.615 |
| MDL Number | MFCD00038878 |
| InChI Key | PNLXWGDXZOYUKB-WCCKRBBISA-N |
| Synonym | h-asp ome-ome hcl, l-aspartic acid dimethyl ester hydrochloride, dimethyl l-aspartate hydrochloride, h-asp ome-ome.hcl, methyl aspartic acid hydrochloride, s-dimethyl 2-aminosuccinate hydrochloride, aspartic acid dimethyl ester hydrochloride, l-aspartic acid dimethyl ester hydro-chloride, s-aminosuccinic acid dimethyl ester hydrochloride, dimethyl aspartic acid hydrochloride |
| PubChem CID | 2734892 |
| IUPAC Name | dimethyl (2S)-2-aminobutanedioate;hydrochloride |
| SMILES | COC(=O)CC(C(=O)OC)N.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity & Availability | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity & Availability | ||||
|
AC376660050
|
N/A | 5 g | Glass Bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 32213-95-9 | |
| 197.615 | |
| PNLXWGDXZOYUKB-WCCKRBBISA-N | |
| 2734892 | |
| COC(=O)CC(C(=O)OC)N.Cl |
| C6H12ClNO4 | |
| MFCD00038878 | |
| h-asp ome-ome hcl, l-aspartic acid dimethyl ester hydrochloride, dimethyl l-aspartate hydrochloride, h-asp ome-ome.hcl, methyl aspartic acid hydrochloride, s-dimethyl 2-aminosuccinate hydrochloride, aspartic acid dimethyl ester hydrochloride, l-aspartic acid dimethyl ester hydro-chloride, s-aminosuccinic acid dimethyl ester hydrochloride, dimethyl aspartic acid hydrochloride | |
| dimethyl (2S)-2-aminobutanedioate;hydrochloride |
Specifications
| 32213-95-9 | |
| Authentic | |
| C6H12ClNO4 | |
| MFCD00038878 | |
| h-asp ome-ome hcl, l-aspartic acid dimethyl ester hydrochloride, dimethyl l-aspartate hydrochloride, h-asp ome-ome.hcl, methyl aspartic acid hydrochloride, s-dimethyl 2-aminosuccinate hydrochloride, aspartic acid dimethyl ester hydrochloride, l-aspartic acid dimethyl ester hydro-chloride, s-aminosuccinic acid dimethyl ester hydrochloride, dimethyl aspartic acid hydrochloride | |
| COC(=O)CC(C(=O)OC)N.Cl | |
| +15° (20°C c=1,Chloroform) | |
| 2734892 | |
| ≥97.5% | |
| L-Aspartic acid dimethyl ester hydrochloride |
| White | |
| 98% | |
| CH3OC(O)CH2CH(NH2)C(O)OCH3·HCl | |
| +13° to +17° (20°C, 589nm) (c=1, CH3OH) | |
| PNLXWGDXZOYUKB-WCCKRBBISA-N | |
| dimethyl (2S)-2-aminobutanedioate;hydrochloride | |
| 197.615 | |
| 197.62 | |
| Crystalline Powder |
RUO – Research Use Only