missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals L-Ascorbic acid sodium salt, 99%
CAS: 134-03-2 | C6H7NaO6 | 198.11 g/mol
Supplier: Thermo Scientific Chemicals 352681000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| L-Ascorbic acid sodium salt | |
| 134-03-2 | |
| White to Yellow | |
| 98.5 to 101.5% (Iodimetry) | |
| C6H7NaO6 | |
| 100 g | |
| + 104.00 | |
| (5% in water) Clear colorless to light yellow | |
| [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O | |
| 198.11 | |
| 198.11 | |
| Crystalline Powder |
| 99% | |
| 219.0°C to 221.0°C | |
| Authentic | |
| Plastic bottle | |
| MFCD00082340 | |
| 15,819 | |
| sodium ascorbate, l-ascorbic acid sodium salt, sodium l-ascorbate, vitamin c sodium, ascorbicin, sodascorbate, cebitate, aminofenitrooxon, natrii ascorbas, monosodium l-ascorbate | |
| IFVCRSPJFHGFCG-HXPAKLQESA-N | |
| sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide | |
| 131674100 | |
| 99% |
Chemical Identifiers
| 134-03-2 | |
| 198.11 | |
| IFVCRSPJFHGFCG-HXPAKLQESA-N | |
| 131674100 | |
| [Na+].OC[C@H](O)C1OC(=O)[C-](O)C1=O |
| C6H7NaO6 | |
| MFCD00082340 | |
| sodium ascorbate, l-ascorbic acid sodium salt, sodium l-ascorbate, vitamin c sodium, ascorbicin, sodascorbate, cebitate, aminofenitrooxon, natrii ascorbas, monosodium l-ascorbate | |
| sodium 5-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-2,4-dioxooxolan-3-ide |
Safety and Handling
EINECSNumber : 205-126-1
RTECSNumber : CI7671000
TSCA : TSCA
RUO – Research Use Only