Learn More
L-(+)-Ascorbic acid, Electrophoresis Grade, 99+%
CAS: 50-81-7 | C6H8O6 | 176.12 g/mol
Supplier: Thermo Scientific Chemicals J6629122
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| L-(+)-Ascorbic acid | |
| 190°C to 193°C (decomposition) | |
| 1.65 g/mL | |
| MFCD00064328 | |
| 84272 | |
| l-ascorbic acid, ascorbic acid, vitamin c, l-ascorbate, ascorbate, ascorbicap, l +-ascorbic acid, cevitamic acid, ascoltin, hybrin | |
| CIWBSHSKHKDKBQ-DOMZIZNONA-N | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one | |
| 54670067 | |
| 176.12 | |
| Electrophoresis |
| 50-81-7 | |
| White | |
| C6H8O6 | |
| 100 g | |
| 14,830 | |
| Soluble in water at 0;5 M | |
| OC[C@H](O)[C@H]1OC(=O)C(O)=C1O | |
| 176.12 | |
| CHEBI:29073 | |
| ≥99% | |
| Powder |
Chemical Identifiers
| 50-81-7 | |
| 176.12 | |
| CIWBSHSKHKDKBQ-DOMZIZNONA-N | |
| 54670067 | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| C6H8O6 | |
| MFCD00064328 | |
| l-ascorbic acid, ascorbic acid, vitamin c, l-ascorbate, ascorbate, ascorbicap, l +-ascorbic acid, cevitamic acid, ascoltin, hybrin | |
| CHEBI:29073 | |
| OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
Safety and Handling
EINECSNumber : 200-066-2
RTECSNumber : CI7650000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only