missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Arginine Monohydrochloride, FCC, 98.5-101.5%, Spectrum™ Chemical
A1338, 1119-34-2, C6H14N4O2·HCl
Supplier: Spectrum Chemical Mfg Cor A1338100GM
Description
Spectrum™ Chemical L-Arginine Monohydrochloride, FCC - The FCC grade meets the requirements of the Food Chemical Codex indicates and is suitable for all food, beverage and nutritional supplement applications. Spectrum Chemical offers over 300 Food grade chemical ingredients packaged in laboratory size bottles to production drum quantities and are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 1119-34-2 | |
| 0.1% | |
| 0.3% | |
| Poly Bottle | |
| KWTQSFXGGICVPE-WCCKRBBISA-N | |
| hydrogen (2S)-2-amino-5-[(diaminomethylidene)amino]pentanoic acid chloride | |
| 210.66 | |
| FCC |
| 100% | |
| 5 mg/kg | |
| C6H15ClN4O2 | |
| +21.3° to +23.5° | |
| [H+].[Cl-].N[C@@H](CCCN=C(N)N)C(O)=O | |
| 100 g | |
| 98.5 to 101.5% |
Chemical Identifiers
| 1119-34-2 | |
| 210.66 | |
| hydrogen (2S)-2-amino-5-[(diaminomethylidene)amino]pentanoic acid chloride |
| C6H15ClN4O2 | |
| KWTQSFXGGICVPE-WCCKRBBISA-N | |
| [H+].[Cl-].N[C@@H](CCCN=C(N)N)C(O)=O |