missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L(+)-Arginine Hydrochloride, 98+%, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals 105000025
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| L(+)-Arginine hydrochloride | |
| 226.0°C | |
| 0.5% max. (105°C, 2 hrs) | |
| 98+% | |
| C6H14N4O2·HCl | |
| MFCD00064550 | |
| 15,77 | |
| + 22 | |
| Solubility in water: 75.1g/100g (20°C) | |
| C(CC(C(=O)O)N)CN=C(N)N.Cl | |
| 95% min. (c=10, H2O, 430nm) 1cm cell | |
| 66250 | |
| 98+% |
| 1119-34-2 | |
| White | |
| Authentic | |
| Plastic bottle | |
| H2NC(=NH)NH(CH2)3CH(NH2)CO2H·HCl | |
| 2.5 kg | |
| +22° (20°C c=8,6N HCl) | |
| l-arginine hydrochloride, arginine hydrochloride, l-arginine hcl, l-arginine monohydrochloride, h-arg-oh.hcl, r-gene, arginine monohydrochloride, argamine, l-arginine, monohydrochloride, unii-f7lth1e20y | |
| KWTQSFXGGICVPE-WCCKRBBISA-N | |
| (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride | |
| 210.67 | |
| 210.67 | |
| Crystalline Powder or Crystals |
Chemical Identifiers
| 1119-34-2 | |
| 210.67 | |
| KWTQSFXGGICVPE-WCCKRBBISA-N | |
| 66250 | |
| C(CC(C(=O)O)N)CN=C(N)N.Cl |
| C6H14N4O2·HCl | |
| MFCD00064550 | |
| l-arginine hydrochloride, arginine hydrochloride, l-arginine hcl, l-arginine monohydrochloride, h-arg-oh.hcl, r-gene, arginine monohydrochloride, argamine, l-arginine, monohydrochloride, unii-f7lth1e20y | |
| (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
Safety and Handling
EINECSNumber : 214-275-1
RUO – Research Use Only