missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Isophthalic acid, 99%
CAS: 121-91-5 | C8H6O4 | 166.13 g/mol
$62.27 - $62.27
Chemical Identifiers
| CAS | 121-91-5 |
|---|---|
| Molecular Formula | C8H6O4 |
| Molecular Weight (g/mol) | 166.13 |
| MDL Number | MFCD00002516 |
| InChI Key | QQVIHTHCMHWDBS-UHFFFAOYSA-N |
| Synonym | isophthalic acid, 1,3-benzenedicarboxylic acid, m-phthalic acid, m-benzenedicarboxylic acid, acide isophtalique, kyselina isoftalova, iso-phthalic acid, acide isophtalique french, kyselina isoftalova czech, unii-x35216h9fj |
| PubChem CID | 8496 |
| ChEBI | CHEBI:30802 |
| IUPAC Name | benzene-1,3-dicarboxylic acid |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC122655000
|
Thermo Scientific Chemicals
122655000 |
500 g | Plastic bottle |
Each for $62.27
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 121-91-5 | |
| 166.13 | |
| QQVIHTHCMHWDBS-UHFFFAOYSA-N | |
| 8496 | |
| benzene-1,3-dicarboxylic acid |
| C8H6O4 | |
| MFCD00002516 | |
| isophthalic acid, 1,3-benzenedicarboxylic acid, m-phthalic acid, m-benzenedicarboxylic acid, acide isophtalique, kyselina isoftalova, iso-phthalic acid, acide isophtalique french, kyselina isoftalova czech, unii-x35216h9fj | |
| CHEBI:30802 | |
| C1=CC(=CC(=C1)C(=O)O)C(=O)O |
Specifications
| 121-91-5 | |
| White | |
| 99% | |
| C8H6O4 | |
| MFCD00002516 | |
| 09, 832 | |
| isophthalic acid, 1,3-benzenedicarboxylic acid, m-phthalic acid, m-benzenedicarboxylic acid, acide isophtalique, kyselina isoftalova, iso-phthalic acid, acide isophtalique french, kyselina isoftalova czech, unii-x35216h9fj | |
| QQVIHTHCMHWDBS-UHFFFAOYSA-N | |
| benzene-1,3-dicarboxylic acid | |
| 8496 | |
| 166.13 | |
| Crystalline Powder |
| 341.0°C to 343.0°C | |
| Authentic | |
| Plastic bottle | |
| C6H4(CO2H)2 | |
| 500 g | |
| 15, 5243 | |
| Solubility in water: 0.01g/100mL (25 c). Other solubilities: freely soluble in alcohol and glacial acetic acid,practically insoluble in benzene and petroleum,ether | |
| C1=CC(=CC(=C1)C(=O)O)C(=O)O | |
| 166.13 | |
| CHEBI:30802 | |
| 99% | |
| Isophthalic acid |
Safety and Handling
EINECSNumber : 204-506-4
RUO – Research Use Only