missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Isobornyl Methacrylate (stabilized with MEHQ) 85.0+%, TCI America™
$57.79 - $238.60
Identifiants chimiques
| CAS | 7534-94-3 |
|---|---|
| Molecular Formula | C14H22O2 |
| Molecular Weight (g/mol) | 222.33 |
| MDL Number | MFCD00081070 |
| InChI Key | IAXXETNIOYFMLW-UHFFFAOYNA-N |
| Synonym | ibma, isobornyl methacrylate, methacrylic acid isobornyl ester, iso-bornyl methacrylate, isobornyl methacrylate, technical grade, isobornyl methacrylate, stabilized with mehq, exo-1,7,7-trimethylbicyclo 2.2.1 hept-, 2-yl methacrylate, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-yl 2-methylprop-2-enoate |
| PubChem CID | 71311141 |
| IUPAC Name | 1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl 2-methylprop-2-enoate |
| SMILES | CC(=C)C(=O)OC1CC2CCC1(C)C2(C)C |
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Prix | Quantité | |||||
|---|---|---|---|---|---|---|---|---|---|
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Prix | Quantité | |||||
|
I061725G
|
TCI America
I061725G |
25 g |
chaque for $57.79
|
|
Connectez-vous ou enregistrez-vous pour vérifier votre prix et la disponibilité.
|
||||
|
I0617500G
|
TCI America
I0617500G |
500 g |
chaque for $238.60
|
|
Connectez-vous ou enregistrez-vous pour vérifier votre prix et la disponibilité.
|
||||
Identifiants chimiques
| 7534-94-3 | |
| 222.33 | |
| IAXXETNIOYFMLW-UHFFFAOYNA-N | |
| 71311141 | |
| CC(=C)C(=O)OC1CC2CCC1(C)C2(C)C |
| C14H22O2 | |
| MFCD00081070 | |
| ibma, isobornyl methacrylate, methacrylic acid isobornyl ester, iso-bornyl methacrylate, isobornyl methacrylate, technical grade, isobornyl methacrylate, stabilized with mehq, exo-1,7,7-trimethylbicyclo 2.2.1 hept-, 2-yl methacrylate, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-yl 2-methylprop-2-enoate | |
| 1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl 2-methylprop-2-enoate |
Spécifications
| 7534-94-3 | |
| 129°C | |
| MFCD00081070 | |
| ibma, isobornyl methacrylate, methacrylic acid isobornyl ester, iso-bornyl methacrylate, isobornyl methacrylate, technical grade, isobornyl methacrylate, stabilized with mehq, exo-1,7,7-trimethylbicyclo 2.2.1 hept-, 2-yl methacrylate, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-yl 2-methylprop-2-enoate | |
| CC(=C)C(=O)OC1CC2CCC1(C)C2(C)C | |
| 222.33 | |
| 222.33 | |
| Liquid |
| Yellow | |
| C14H22O2 | |
| 25 g | |
| IAXXETNIOYFMLW-UHFFFAOYNA-N | |
| 1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl 2-methylprop-2-enoate | |
| 71311141 | |
| ≥85.0% (GC) | |
| Isobornyl Methacrylate (stabilized with MEHQ) |
Sécurité et manipulation
missing translation for 'einecsNumber' : (4)-1492
missing translation for 'tsca' : Yes