missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Isobornyl Methacrylate (stabilized with MEHQ) 85.0+%, TCI America™
Supplier: TCI America I061725G
Specifications
| Isobornyl Methacrylate (stabilized with MEHQ) | |
| Yellow | |
| C14H22O2 | |
| 25 g | |
| IAXXETNIOYFMLW-UHFFFAOYNA-N | |
| 1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl 2-methylprop-2-enoate | |
| 71311141 | |
| ≥85.0% (GC) |
| 7534-94-3 | |
| 129°C | |
| MFCD00081070 | |
| ibma, isobornyl methacrylate, methacrylic acid isobornyl ester, iso-bornyl methacrylate, isobornyl methacrylate, technical grade, isobornyl methacrylate, stabilized with mehq, exo-1,7,7-trimethylbicyclo 2.2.1 hept-, 2-yl methacrylate, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-yl 2-methylprop-2-enoate | |
| CC(=C)C(=O)OC1CC2CCC1(C)C2(C)C | |
| 222.33 | |
| 222.33 | |
| Liquid |
Chemical Identifiers
| 7534-94-3 | |
| 222.33 | |
| IAXXETNIOYFMLW-UHFFFAOYNA-N | |
| 71311141 | |
| CC(=C)C(=O)OC1CC2CCC1(C)C2(C)C |
| C14H22O2 | |
| MFCD00081070 | |
| ibma, isobornyl methacrylate, methacrylic acid isobornyl ester, iso-bornyl methacrylate, isobornyl methacrylate, technical grade, isobornyl methacrylate, stabilized with mehq, exo-1,7,7-trimethylbicyclo 2.2.1 hept-, 2-yl methacrylate, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-yl 2-methylprop-2-enoate | |
| 1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl 2-methylprop-2-enoate |
Safety and Handling
EINECSNumber : (4)-1492
TSCA : Yes