missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Hydroxylamine Sulfate, ACS, 99%, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor H2357500GM
Specifications
| 10039-54-0 | |
| 0.0005 | |
| H8N2O6S | |
| VGYYSIDKAKXZEE-UHFFFAOYSA-L | |
| bis(hydroxyazanium) sulfate | |
| 0.99 |
| 1 | |
| Poly Bottle | |
| 500 g | |
| [NH3+]O.[NH3+]O.[O-]S([O-])(=O)=O | |
| 164.13 | |
| ACS |
Chemical Identifiers
| 10039-54-0 | |
| 164.13 | |
| bis(hydroxyazanium) sulfate |
| H8N2O6S | |
| VGYYSIDKAKXZEE-UHFFFAOYSA-L | |
| [NH3+]O.[NH3+]O.[O-]S([O-])(=O)=O |
CAUTION: For manufacturing or laboratory use only. Not for food or drug use. Read and understand the label and Safety Data Sheet (SDS) prior to use.