missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Hexadecafluoroheptane (mixture of isomers) 80.0+%, TCI America™
Supplier: TCI America P085110G
Specifications
| Hexadecafluoroheptane (mixture of isomers) | |
| Colorless | |
| C7F16 | |
| 10 g | |
| LGUZHRODIJCVOC-UHFFFAOYSA-N | |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecafluoroheptane | |
| 9553 | |
| 388.05 | |
| Liquid |
| 335-57-9 | |
| 82°C | |
| MFCD00040339 | |
| hexadecafluoroheptane, perfluoroheptane, perfluoro-n-heptane, heptane, hexadecafluoro, perfluoroheptanes, unii-i23zvd1p1l, i23zvd1p1l, heptane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecafluoro, perfluoroheptane s, acmc-20akry | |
| C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F | |
| 388.051 | |
| CHEBI:38847 | |
| ≥80.0% (GC) |
Chemical Identifiers
| 335-57-9 | |
| 388.051 | |
| LGUZHRODIJCVOC-UHFFFAOYSA-N | |
| 9553 | |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecafluoroheptane |
| C7F16 | |
| MFCD00040339 | |
| hexadecafluoroheptane, perfluoroheptane, perfluoro-n-heptane, heptane, hexadecafluoro, perfluoroheptanes, unii-i23zvd1p1l, i23zvd1p1l, heptane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-hexadecafluoro, perfluoroheptane s, acmc-20akry | |
| CHEBI:38847 | |
| C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Safety and Handling
EINECSNumber : (2)-2366
RTECSNumber : MJ0875000
TSCA : Yes