missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific™ HEPES, 99%, for biochemistry
Supplier: Thermo Scientific™ 172570010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Biological bufferSpecifications
| 0.08 max. at 260nm, 0.05 max. at 280nm, 0.08 max. at 250nm, (5% in water) 1 cm cell, (5% in water) 1 cm cell at 0nm | |
| (5% aq. soln.) (1cm cell) | |
| 238°C | |
| 99% | |
| 1 % max. (1 g, 105°C, 3 hrs) | |
| MFCD00006158 | |
| 23, V,2, 379 | |
| 2-[4-(2-Hydroxyethyl)-1-piperazine]ethanesulfonic acid | |
| RDZTWEVXRGYCFV-UHFFFAOYSA-M | |
| 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid | |
| 23831 | |
| 238.3 | |
| Biochemical |
| HEPES | |
| 7365-45-9 | |
| 1kg | |
| Authentic | |
| C8H17N2NaO4S | |
| Glass bottle | |
| 15, 4689 | |
| Solubility in water: 704g/L (20°C). | |
| [Na+].OCCN1CCN(CCS([O-])(=O)=O)CC1 | |
| 260.28 | |
| CHEBI:42334 | |
| 99% |
Chemical Identifiers
| 7365-45-9 | |
| C8H17N2NaO4S | |
| MFCD00006158 |
| 99% | |
| 238.3 | |
| HEPES |
RUO â Research Use Only