missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Hemin, 95%, MP Biomedicals™
Manufacturer: Mp Biomedicals 0219882001
Specifications
| Hemin | |
| Black | |
| 16009-13-5 | |
| chlorohemin, ferriheme, ferriprotoporphyrin, ferriprotoporphyrin ix, ferriprotoporphyrin ix chloride, hemin chloride, panhematin, protoferriheme, protohemin, protohemin ix | |
| CC1=C(C2=CC3=NC(=CC4=C(C(=C(N4)C=C5C(=C(C(=N5)C=C1[N-]2)C)C=C)C)C=C)C(=C3CCC(=O)O)C)CCC(=O)O.Cl.[Fe] | |
| 653.965 | |
| 652 | |
| 0.95 |
| 7.87g/cm3 at 25°C | |
| 1g | |
| C34H34ClFeN4O4- | |
| WABFTRRMMIIYHI-UHFFFAOYSA-M | |
| 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-23H-porphyrin-21-id-2-yl]propanoic acid;iron;hydrochloride | |
| 131675604 | |
| Crystalline Powder |
Chemical Identifiers
| 16009-13-5 | |
| 653.965 | |
| chlorohemin, ferriheme, ferriprotoporphyrin, ferriprotoporphyrin ix, ferriprotoporphyrin ix chloride, hemin chloride, panhematin, protoferriheme, protohemin, protohemin ix | |
| 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethyl-23H-porphyrin-21-id-2-yl]propanoic acid;iron;hydrochloride |
| C34H34ClFeN4O4- | |
| WABFTRRMMIIYHI-UHFFFAOYSA-M | |
| 131675604 | |
| CC1=C(C2=CC3=NC(=CC4=C(C(=C(N4)C=C5C(=C(C(=N5)C=C1[N-]2)C)C=C)C)C=C)C(=C3CCC(=O)O)C)CCC(=O)O.Cl.[Fe] |