missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Hematoxylin (Certified Biological Stain), Fisher Chemical™ 
For use in histology and cytology
Supplier: Thermo Fisher Scientific H345100
Catalog No. H345-100
Specifications
| Hematoxylin | |
| 517-28-2 | |
| C16H14O6 | |
| Natural Black 1, Hydroxybrasilin | |
| [H][C@]12C3=C(C[C@@]1(O)COC1=C2C=CC(O)=C1O)C=C(O)C(O)=C3 | |
| 302.28 | |
| 302.28 | |
| Glass Bottle | |
| Amber | |
| Powder |
| 100°C | |
| Pass Test | |
| MFCD00078111 | |
| WZUVPPKBWHMQCE-WKTCHCBJNA-N | |
| (1R,10S)-8-oxatetracyclo[8.7.0.0²,â·.0¹²,¹â·]heptadeca-2(7),3,5,12(17),13,15-hexaene-5,6,10,14,15-pentol | |
| 45029742 | |
| Certified Biological Stain | |
| 75290 | |
| 100 g |
Chemical Identifiers
| 517-28-2 | |
| 302.28 | |
| WZUVPPKBWHMQCE-WKTCHCBJNA-N | |
| 45029742 | |
| [H][C@]12C3=C(C[C@@]1(O)COC1=C2C=CC(O)=C1O)C=C(O)C(O)=C3 |
| C16H14O6 | |
| MFCD00078111 | |
| Natural Black 1, Hydroxybrasilin | |
| (1R,10S)-8-oxatetracyclo[8.7.0.0²,â·.0¹²,¹â·]heptadeca-2(7),3,5,12(17),13,15-hexaene-5,6,10,14,15-pentol |
Safety and Handling