missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Fisher Scientific Hematoxylin (Certified Biological Stain), Fisher Chemical™ 
For use in histology and cytology
Supplier: Thermo Fisher Scientific H345100
Catalog No. H345-100
Specifications
| Hematoxylin | |
| Pass Test | |
| MFCD00078111 | |
| WZUVPPKBWHMQCE-VYIIXAMBSA-N | |
| (6aR)-7,11b-dihydro-6H-indeno[2,1-c]chromene-3,4,6a,9,10-pentol | |
| 45029742 | |
| Powder/Solid | |
| Glass Bottle | |
| 100°C | |
| 100g |
| 517-28-2 | |
| C16H14O6 | |
| Natural Black 1, Hydroxybrasilin | |
| C1C2=CC(=C(C=C2C3C1(COC4=C3C=CC(=C4O)O)O)O)O | |
| 302.282 | |
| 302.28 | |
| Certified Biological Stain | |
| 75290 | |
| Amber |
Chemical Identifiers
| 517-28-2 | |
| 302.282 | |
| WZUVPPKBWHMQCE-VYIIXAMBSA-N | |
| 45029742 | |
| C1C2=CC(=C(C=C2C3C1(COC4=C3C=CC(=C4O)O)O)O)O |
| C16H14O6 | |
| MFCD00078111 | |
| Natural Black 1, Hydroxybrasilin | |
| (6aR)-7,11b-dihydro-6H-indeno[2,1-c]chromene-3,4,6a,9,10-pentol |
Safety and Handling