missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Glycerine trioleate, 98%
CAS: 122-32-7 | C57H104O6 | 885.45 g/mol
Supplier: Thermo Scientific Chemicals 368120050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Glycerine trioleate | |
| Colorless to Yellow | |
| 235.0°C to 240.0°C (18.0 mmHg) | |
| 98.5% min. (GC) | |
| C57H104O6 | |
| (C17H33COOCH2)2CHOCOC17H33 | |
| 5 mL | |
| 0.913 | |
| triolein, glycerol trioleate, glyceryl trioleate, oleic triglyceride, trioleoylglycerol, glycerol triolein, oleic acid triglyceride, trioleoylglyceride, olein, glycerin trioleate | |
| PHYFQTYBJUILEZ-BSCDBXJPSA-N | |
| [2-[(Z)-octadec-9-enoyl]oxy-3-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate | |
| 45253964 | |
| 99% |
| 122-32-7 | |
| 0.9130g/mL | |
| Authentic | |
| Glass bottle | |
| 1.4680 to 1.4700 | |
| MFCD00137563 | |
| 02,IV,1664 | |
| 15,9904 | |
| Solubility in water: insoluble in water. Other solubilities: soluble in chloroform, ether, ccl4, slightly soluble in alcohol | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
| 885.45 | |
| 885.45 | |
| Liquid |
Chemical Identifiers
| 122-32-7 | |
| 885.45 | |
| PHYFQTYBJUILEZ-BSCDBXJPSA-N | |
| 45253964 | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC |
| C57H104O6 | |
| MFCD00137563 | |
| triolein, glycerol trioleate, glyceryl trioleate, oleic triglyceride, trioleoylglycerol, glycerol triolein, oleic acid triglyceride, trioleoylglyceride, olein, glycerin trioleate | |
| [2-[(Z)-octadec-9-enoyl]oxy-3-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate |
Safety and Handling
EINECSNumber : 204-534-7
RUO – Research Use Only