missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Glucosamine Hydrochloride Dietary Supplement, USP, 98-102%, Spectrum™ Chemical
G1094, 66-84-2, C6H13NO5·HCl
Supplier: Spectrum Chemical Mfg Cor G1094100GM
Description
Spectrum™ Chemical Glucosamine Hydrochloride, USP Dietary SupplementSpecifications
| 66-84-2 | |
| 0.1% | |
| Amber Glass Bottle | |
| 100 g | |
| CBOJBBMQJBVCMW-UHFFFAOYNA-N | |
| hydrogen 2-amino-3,4,5,6-tetrahydroxyhexanal chloride | |
| 98 to 102% |
| 100% | |
| 1% | |
| C6H14ClNO5 | |
| +70.0° to +73.0 | |
| [H+].[Cl-].NC(C=O)C(O)C(O)C(O)CO | |
| 215.63 | |
| USP Dietary Supplement |
Chemical Identifiers
| 66-84-2 | |
| 215.63 | |
| hydrogen 2-amino-3,4,5,6-tetrahydroxyhexanal chloride |
| C6H14ClNO5 | |
| CBOJBBMQJBVCMW-UHFFFAOYNA-N | |
| [H+].[Cl-].NC(C=O)C(O)C(O)C(O)CO |