missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Glipizide, 98+%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 329110010
| Quantity | 1g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 29094-61-9 | |
| 445.5 | |
| ZJJXGWJIGJFDTL-UHFFFAOYSA-N | |
| 3478 | |
| N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-5-methylpyrazine-2-carboxamide |
| C21H27N5O4S | |
| MFCD00072159 | |
| glipizide, glucotrol, glydiazinamide, melizide, glibenese, glucozide, glupizide, sucrazide, dipazide, glupitel | |
| CHEBI:5384 | |
| CC1=NC=C(N=C1)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)NC3CCCCC3 |
Specifications
| Glipizide | |
| 0.4% max. | |
| Authentic | |
| Glass Bottle | |
| 1g | |
| 15, 4477 | |
| Solubility in water: insoluble. Other solubilities: soluble in dmso and methanol | |
| CC1=NC=C(N=C1)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)NC3CCCCC3 | |
| 445.5 | |
| CHEBI:5384 | |
| 98+% |
| 29094-61-9 | |
| 1% max. (100°C, 3 hrs) (vacuum) | |
| 98% min. (HPLC) | |
| C21H27N5O4S | |
| MFCD00072159 | |
| glipizide, glucotrol, glydiazinamide, melizide, glibenese, glucozide, glupizide, sucrazide, dipazide, glupitel | |
| ZJJXGWJIGJFDTL-UHFFFAOYSA-N | |
| N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-5-methylpyrazine-2-carboxamide | |
| 3478 | |
| 445.5 |
Safety and Handling
EINECSNumber : 249-427-6