Learn More
Gliclazide, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 461070010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Gliclazide | |
| 0.5% max. (1 g, 105°C) | |
| C15H21N3O3S | |
| 1g | |
| Solubility in water: insoluble. Other solubilities: soluble in dmf, slightly soluble in methanol, ethanol | |
| CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NN1CC2CCCC2C1 | |
| 323.41 | |
| CHEBI:31654 | |
| ≥98.5% (HPLC) |
| 21187-98-4 | |
| Authentic | |
| MFCD00409893 | |
| gliclazide, glimicron, diamicron, nordialex, diaikron, gliclazida, gliklazid, glyclazide, gliclazidum inn-latin, gliclazida inn-spanish | |
| BOVGTQGAOIONJV-UHFFFAOYNA-N | |
| 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(4-methylphenyl)sulfonylurea | |
| 3475 | |
| 323.41 |
Chemical Identifiers
| 21187-98-4 | |
| 323.41 | |
| BOVGTQGAOIONJV-UHFFFAOYNA-N | |
| 3475 | |
| 1-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-3-(4-methylphenyl)sulfonylurea |
| C15H21N3O3S | |
| MFCD00409893 | |
| gliclazide, glimicron, diamicron, nordialex, diaikron, gliclazida, gliklazid, glyclazide, gliclazidum inn-latin, gliclazida inn-spanish | |
| CHEBI:31654 | |
| CC1=CC=C(C=C1)S(=O)(=O)NC(=O)NN1CC2CCCC2C1 |
Safety and Handling
GHS H Statement Suspected of damaging fertility or the unborn child.
GHS P Statement Obtain special instructions before use. Wear protective gloves/protective clothing/eye protection/face protection. IF exposed or concerned: Get medical advice/attention.
GHS Signal Word: Warning
EINECSNumber : 244-260-5
RUO â Research Use Only