missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Gestodene, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 468650010
Specifications
| Gestodene | |
| Available | |
| Powder | |
| 00867858 | |
| 197.9°C | |
| 13beta-Ethyl-17beta-hydroxy-18,19-dinorpregna-4,15-dien-20-yn-3-one | |
| CCC12CCC3C(CCC4=CC(=O)CCC34)C1C=C[C@@]2(O)C#C | |
| 310.44 | |
| 310.43 |
| Glass Bottle | |
| 60282-87-3 | |
| C21H26O2 | |
| White to Beige | |
| 4425 | |
| SIGSPDASOTUPFS-KQMXEUTGSA-N | |
| (1R)-11a-ethyl-1-ethynyl-1-hydroxy-1H,3aH,3bH,4H,5H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-7-one | |
| 1 g |
Chemical Identifiers
| 60282-87-3 | |
| 310.44 | |
| SIGSPDASOTUPFS-KQMXEUTGSA-N | |
| (1R)-11a-ethyl-1-ethynyl-1-hydroxy-1H,3aH,3bH,4H,5H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-7-one |
| C21H26O2 | |
| 00867858 | |
| 13beta-Ethyl-17beta-hydroxy-18,19-dinorpregna-4,15-dien-20-yn-3-one | |
| CCC12CCC3C(CCC4=CC(=O)CCC34)C1C=C[C@@]2(O)C#C |
Safety and Handling
GHS08: Health hazard
ShelfLife : 5 years
EINECSNumber : 262-145-8
RTECSNumber : JF7956000
Recommended Storage : Freezer -20°C