Learn More
Gentian Violet, Reagent Grade, LabChem™
Supplier: LabChem LC147908
| Quantity | 25 g |
|---|
Chemical Identifiers
| 548-62-9 | |
| 407.986 | |
| 11057 | |
| [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride |
| C25H30ClN3 | |
| ZXJXZNDDNMQXFV-UHFFFAOYSA-M | |
| CHEBI:41688 | |
| CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] |
Specifications
| Gentian Violet | |
| 548-62-9 | |
| C25H30ClN3 | |
| Soluble in water | |
| ZXJXZNDDNMQXFV-UHFFFAOYSA-M | |
| [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride | |
| 11057 | |
| 407.99 | |
| Amber Glass | |
| Carbon monoxide; Carbon dioxide; Nitrogen oxides | |
| Green | |
| Powder |
| 173°C | |
| 100 | |
| C25H30CIN3 | |
| Passes Test | |
| CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] | |
| 407.986 | |
| CHEBI:41688 | |
| Reagent | |
| 1.19g/cm3 | |
| 1.19g/cm3 | |
| 25 g |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes serious eye damage.
Suspected of causing cancer.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Obtain special instructions before use.
Do not handle until all safety precautions have been read and understood.
Do not eat, drink or smoke when using this product.
Wear eye protection, protective gloves.
Wash exposed skin thoroughly after handling.
Avoid release to the environment.
If exposed or concerned: Get medical advice/attention.
If swallowed: Rinse month.
Call a poison center/doctor if you feel unwell.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
Immediately call a poison center/doctor.
Collect spillage.
Store locked up.
Dispose of contents/container to comply with local, state and federal regulations.
Danger
EINECSNumber : 208-953-6
Recommended Storage : Room Temperature