Learn More
Gemcitabine, 98%
CAS: 95058-81-4 | C9H11F2N3O4 | 263.2 g/mol
$238.72 - $581.53
Chemical Identifiers
| CAS | 95058-81-4 |
|---|---|
| Molecular Formula | C9H11F2N3O4 |
| Molecular Weight (g/mol) | 263.2 |
| InChI Key | SDUQYLNIPVEERB-QPPQHZFASA-N |
| Synonym | gemcitabine, 2',2'-difluorodeoxycytidine, gemcitabinum, gamcitabine, gemcitabina, gemcitabine hcl, dfdc, 2'-deoxy-2',2'-difluorocytidine, folfugem, gemcel |
| PubChem CID | 60750 |
| ChEBI | CHEBI:175901 |
| IUPAC Name | 4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)(F)F |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC456890010
|
Thermo Scientific Chemicals
456890010 |
1 g |
Each for $238.72
|
|
|||||
|
AC456890050
|
Thermo Scientific Chemicals
456890050 |
5 g |
Each for $581.53
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 95058-81-4 | |
| 263.2 | |
| gemcitabine, 2',2'-difluorodeoxycytidine, gemcitabinum, gamcitabine, gemcitabina, gemcitabine hcl, dfdc, 2'-deoxy-2',2'-difluorocytidine, folfugem, gemcel | |
| CHEBI:175901 | |
| C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)(F)F |
| C9H11F2N3O4 | |
| SDUQYLNIPVEERB-QPPQHZFASA-N | |
| 60750 | |
| 4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
Specifications
| 95058-81-4 | |
| 2% max. | |
| 97.5% min. (HPLC) | |
| C9H11F2N3O4 | |
| gemcitabine, 2',2'-difluorodeoxycytidine, gemcitabinum, gamcitabine, gemcitabina, gemcitabine hcl, dfdc, 2'-deoxy-2',2'-difluorocytidine, folfugem, gemcel | |
| C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)(F)F | |
| 263.2 | |
| CHEBI:175901 | |
| 98% |
| 292.0°C | |
| Authentic | |
| Glass Bottle | |
| 1 g | |
| SDUQYLNIPVEERB-QPPQHZFASA-N | |
| 4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one | |
| 60750 | |
| 263.2 | |
| Gemcitabine |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
Suspected of damaging fertility.
Suspected of damaging the unborn child.
May cause damage to organs through prolonged or repeated exposure if inhaled.<br
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
Take off contaminated clothing and wash before reuse.
IF IN EYES: Rinse cautiously with water
GHS Signal Word: Warning
RUO – Research Use Only