Learn More
Gatifloxacin, 98%, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals 460230010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Gatifloxacin | |
| 185.0°C to 187.0°C | |
| Authentic | |
| Glass Bottle | |
| MFCD00895399 | |
| gatifloxacin, tequin, zymar, gatiflo, gatifloxacine, gatiquin, gatispan, gatilox, zymaxid, gaity | |
| COC1=C2N(C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCNC(C)C1)C1CC1 | |
| 375.40 | |
| CHEBI:5280 | |
| 98% |
| 112811-59-3 | |
| 4% to 8% | |
| 97.5% min. (HPLC) | |
| C19H22FN3O4 | |
| 1 g | |
| XUBOMFCQGDBHNK-UHFFFAOYNA-N | |
| 1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid | |
| 5379 | |
| 375.39 |
Chemical Identifiers
| 112811-59-3 | |
| 375.40 | |
| XUBOMFCQGDBHNK-UHFFFAOYNA-N | |
| 5379 | |
| 1-cyclopropyl-6-fluoro-8-methoxy-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| C19H22FN3O4 | |
| MFCD00895399 | |
| gatifloxacin, tequin, zymar, gatiflo, gatifloxacine, gatiquin, gatispan, gatilox, zymaxid, gaity | |
| CHEBI:5280 | |
| COC1=C2N(C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCNC(C)C1)C1CC1 |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
Harmful if inhaled.
GHS P Statement
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF INHALED: Remove to fresh air and keep at rest in a position
GHS Signal Word: Warning
RUO – Research Use Only