missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Gallic acid ethyl ester, 99%
CAS: 831-61-8 | C9H10O5 | 198.174 g/mol
Supplier: Thermo Scientific Chemicals 279931000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Gallic acid ethyleester | |
| 151°C to 154°C | |
| Authentic | |
| C9H10O5 | |
| 100 g | |
| ethyl gallate, gallic acid ethyl ester, phyllemblin, nipagallin a, progallin a, ethylgallate, nipa no. 48, gallic acid, ethyl ester, benzoic acid, 3,4,5-trihydroxy-, ethyl ester, nipa 48 | |
| CCOC(=O)C1=CC(=C(C(=C1)O)O)O | |
| 198.174 | |
| CHEBI:87247 | |
| ≥98.5% |
| 831-61-8 | |
| White to Beige | |
| Glass bottle | |
| MFCD00016430 | |
| 10, 484 | |
| VFPFQHQNJCMNBZ-UHFFFAOYSA-N | |
| ethyl 3,4,5-trihydroxybenzoate | |
| 13250 | |
| 198.18 | |
| Fine Powder |
Chemical Identifiers
| 831-61-8 | |
| 198.174 | |
| VFPFQHQNJCMNBZ-UHFFFAOYSA-N | |
| 13250 | |
| ethyl 3,4,5-trihydroxybenzoate |
| C9H10O5 | |
| MFCD00016430 | |
| ethyl gallate, gallic acid ethyl ester, phyllemblin, nipagallin a, progallin a, ethylgallate, nipa no. 48, gallic acid, ethyl ester, benzoic acid, 3,4,5-trihydroxy-, ethyl ester, nipa 48 | |
| CHEBI:87247 | |
| CCOC(=O)C1=CC(=C(C(=C1)O)O)O |
RUO – Research Use Only