missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Gallic acid ethyl ester, 99%
CAS: 831-61-8 | C9H10O5 | 198.174 g/mol
$150.51 - $150.51
Chemical Identifiers
| CAS | 831-61-8 |
|---|---|
| Molecular Formula | C9H10O5 |
| Molecular Weight (g/mol) | 198.174 |
| MDL Number | MFCD00016430 |
| InChI Key | VFPFQHQNJCMNBZ-UHFFFAOYSA-N |
| Synonym | ethyl gallate, gallic acid ethyl ester, phyllemblin, nipagallin a, progallin a, ethylgallate, nipa no. 48, gallic acid, ethyl ester, benzoic acid, 3,4,5-trihydroxy-, ethyl ester, nipa 48 |
| PubChem CID | 13250 |
| ChEBI | CHEBI:87247 |
| IUPAC Name | ethyl 3,4,5-trihydroxybenzoate |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC279931000
|
Thermo Scientific Chemicals
279931000 |
100 g | Glass bottle |
Each for $150.51
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 831-61-8 | |
| 198.174 | |
| VFPFQHQNJCMNBZ-UHFFFAOYSA-N | |
| 13250 | |
| ethyl 3,4,5-trihydroxybenzoate |
| C9H10O5 | |
| MFCD00016430 | |
| ethyl gallate, gallic acid ethyl ester, phyllemblin, nipagallin a, progallin a, ethylgallate, nipa no. 48, gallic acid, ethyl ester, benzoic acid, 3,4,5-trihydroxy-, ethyl ester, nipa 48 | |
| CHEBI:87247 | |
| CCOC(=O)C1=CC(=C(C(=C1)O)O)O |
Specifications
| 831-61-8 | |
| White to Beige | |
| Glass bottle | |
| MFCD00016430 | |
| 10, 484 | |
| VFPFQHQNJCMNBZ-UHFFFAOYSA-N | |
| ethyl 3,4,5-trihydroxybenzoate | |
| 13250 | |
| 198.18 | |
| Fine Powder |
| 151°C to 154°C | |
| Authentic | |
| C9H10O5 | |
| 100 g | |
| ethyl gallate, gallic acid ethyl ester, phyllemblin, nipagallin a, progallin a, ethylgallate, nipa no. 48, gallic acid, ethyl ester, benzoic acid, 3,4,5-trihydroxy-, ethyl ester, nipa 48 | |
| CCOC(=O)C1=CC(=C(C(=C1)O)O)O | |
| 198.174 | |
| CHEBI:87247 | |
| ≥98.5% | |
| Gallic acid ethyleester |
RUO – Research Use Only