missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Fluorescein diacetate, 97%, pure
CAS: 596-09-8 | C24H16O7 | 416.39 g/mol
$158.48 - $579.27
Chemical Identifiers
| CAS | 596-09-8 |
|---|---|
| Molecular Formula | C24H16O7 |
| Molecular Weight (g/mol) | 416.39 |
| MDL Number | MFCD00005062 |
| InChI Key | CHADEQDQBURGHL-UHFFFAOYSA-N |
| Synonym | fluorescein diacetate, 3,6-diacetoxyfluoran, diacetylfluorescein, di-o-acetylfluorescein, fluorescein, diacetate, 3',6'-diacetylfluorescein, unii-yl39r93pre, yl39r93pre, spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy, 3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate |
| PubChem CID | 65047 |
| IUPAC Name | (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC191660050
|
Thermo Scientific Chemicals
191660050 |
5 g | Glass bottle |
Each for $158.48
|
|
||||
|
AC191660250
|
Thermo Scientific Chemicals
191660250 |
25 g | Glass bottle |
Each for $579.27
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 596-09-8 | |
| 416.39 | |
| CHADEQDQBURGHL-UHFFFAOYSA-N | |
| 65047 | |
| CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3 |
| C24H16O7 | |
| MFCD00005062 | |
| fluorescein diacetate, 3,6-diacetoxyfluoran, diacetylfluorescein, di-o-acetylfluorescein, fluorescein, diacetate, 3',6'-diacetylfluorescein, unii-yl39r93pre, yl39r93pre, spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy, 3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate | |
| (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
Specifications
| 596-09-8 | |
| Yellow | |
| 96% min. (HPLC) | |
| C24H16O7 | |
| 5 g | |
| fluorescein diacetate, 3,6-diacetoxyfluoran, diacetylfluorescein, di-o-acetylfluorescein, fluorescein, diacetate, 3',6'-diacetylfluorescein, unii-yl39r93pre, yl39r93pre, spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy, 3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate | |
| CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3 | |
| 416.39 | |
| 416.39 | |
| Pure | |
| Fluorescein diacetate |
| 200.0°C to 205.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00005062 | |
| 19,227 | |
| CHADEQDQBURGHL-UHFFFAOYSA-N | |
| (6'-acetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate | |
| 65047 | |
| 97% | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : 209-877-6
RUO – Research Use Only