missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Fluorene-9-carboxylic acid, 97%
CAS: 1989-33-9 | C14H10O2 | 210.232 g/mol
$75.03 - $803.22
Chemical Identifiers
| CAS | 1989-33-9 |
|---|---|
| Molecular Formula | C14H10O2 |
| Molecular Weight (g/mol) | 210.232 |
| MDL Number | MFCD00001136 |
| InChI Key | DNVJGJUGFFYUPT-UHFFFAOYSA-N |
| Synonym | fluorene-9-carboxylic acid, 9-fluorenecarboxylic acid, 9-carboxyfluorene, diphenyleneacetic acid, 9-fluorencarboxylic acid, rarechem aq bd 0ba1, akos auf02021, 9-carboxy-9h-fluorene, enamine_003081, 9-fluorenylcarboxylic acid |
| PubChem CID | 74809 |
| IUPAC Name | 9H-fluorene-9-carboxylic acid |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAB2322406
|
Thermo Scientific Chemicals
B2322406 |
5 g |
Each for $75.03
|
|
|||||
|
AAB2322414
|
Thermo Scientific Chemicals
B2322414 |
25 g |
Each for $233.01
|
|
|||||
|
AAB2322422
|
Thermo Scientific Chemicals
B2322422 |
100 g |
Each for $803.22
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1989-33-9 | |
| 210.232 | |
| DNVJGJUGFFYUPT-UHFFFAOYSA-N | |
| 74809 | |
| C1=CC=C2C(=C1)C(C3=CC=CC=C32)C(=O)O |
| C14H10O2 | |
| MFCD00001136 | |
| fluorene-9-carboxylic acid, 9-fluorenecarboxylic acid, 9-carboxyfluorene, diphenyleneacetic acid, 9-fluorencarboxylic acid, rarechem aq bd 0ba1, akos auf02021, 9-carboxy-9h-fluorene, enamine_003081, 9-fluorenylcarboxylic acid | |
| 9H-fluorene-9-carboxylic acid |
Specifications
| 1989-33-9 | |
| 230°C (446°F) | |
| MFCD00001136 | |
| 1911728 | |
| DNVJGJUGFFYUPT-UHFFFAOYSA-N | |
| 9H-fluorene-9-carboxylic acid | |
| 74809 | |
| 97% |
| 226°C to 232°C | |
| C14H10O2 | |
| 5 g | |
| fluorene-9-carboxylic acid, 9-fluorenecarboxylic acid, 9-carboxyfluorene, diphenyleneacetic acid, 9-fluorencarboxylic acid, rarechem aq bd 0ba1, akos auf02021, 9-carboxy-9h-fluorene, enamine_003081, 9-fluorenylcarboxylic acid | |
| C1=CC=C2C(=C1)C(C3=CC=CC=C32)C(=O)O | |
| 210.232 | |
| 210.23 | |
| Fluorene-9-carboxylic acid |
Safety and Handling
EINECSNumber : 217-866-2
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only