missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethylenediaminetetraacetic Acid, Honeywell Fluka™
for complexometry,≥99.0%
Supplier: Honeywell-Fluka 036101KG
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Ethylenediaminetetraacetic Acid | |
| ≤0.1% (as SO4) | |
| C10H16N2O8 | |
| MFCD00003541 | |
| 1716295 | |
| Soluble in water (0.4g/L at 20°C) | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
| 292.24 | |
| CHEBI:42191 | |
| ≥99% |
| 60-00-4 | |
| Plastic Bottle | |
| (HO2CCH2)2NCH2CH2N(CH2CO2H)2 | |
| 1 kg | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid | |
| 6049 | |
| 292.24g/mol |
Chemical Identifiers
| 60-00-4 | |
| 292.24 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| C10H16N2O8 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| CHEBI:42191 |
Safety and Handling
P305 + P351 + P338
H319
EINECSNumber : 200-449-4
RTECSNumber : AH4025000